C35H39NO7 — CID 150306586
(2S)-2-ethoxy-3-[4-[3-[[[6-(2-methoxyethoxymethoxy)naphthalene-2-carbonyl]-methylamino]methyl]phenyl]phenyl]-2-methylpropanoic acid (PubChem CID 150306586) has the molecular formula C35H39NO7 and a molecular weight of 585.70 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[3-[[[6-(2-methoxyethoxymethoxy)naphthalene-2-carbonyl]-methylamino]methyl]phenyl]phenyl]-2-methylpropanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[3-[[[6-(2-methoxyethoxymethoxy)naphthalene-2-carbonyl]-methylamino]methyl]phenyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 150306586 |
| Molecular Formula | C35H39NO7 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[3-[[[6-(2-methoxyethoxymethoxy)naphthalene-2-carbonyl]-methylamino]methyl]phenyl]phenyl]-2-methylpropanoic acid |
| SMILES | CCO[C@@](C)(Cc1ccc(-c2cccc(CN(C)C(=O)c3ccc4cc(OCOCCOC)ccc4c3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C35H39NO7/c1-5-43-35(2,34(38)39)22-25-9-11-27(12-10-25)28-8-6-7-26(19-28)23-36(3)33(37)31-14-13-30-21-32(16-15-29(30)20-31)42-24-41-18-17-40-4/h6-16,19-21H,5,17-18,22-24H2,1-4H3,(H,38,39)/t35-/m0/s1 |
| InChIKey | GKSKWLXGIQVDEL-DHUJRADRSA-N |
| XLogP | 6.20 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|