C34H32N2O5S — CID 10393435
N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-4-[4-(2-methoxyethoxy)phenyl]-N-methylbenzamide (PubChem CID 10393435) has the molecular formula C34H32N2O5S and a molecular weight of 580.71 g/mol. Its IUPAC name is N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-4-[4-(2-methoxyethoxy)phenyl]-N-methylbenzamide.
| Compound Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-4-[4-(2-methoxyethoxy)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 10393435 |
| Molecular Formula | C34H32N2O5S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-4-[4-(2-methoxyethoxy)phenyl]-N-methylbenzamide |
| SMILES | COCCOc1ccc(-c2ccc(C(=O)N(C)Cc3cccc(-c4ccc(CC5SC(=O)NC5=O)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C34H32N2O5S/c1-36(33(38)28-12-10-25(11-13-28)26-14-16-30(17-15-26)41-19-18-40-2)22-24-4-3-5-29(20-24)27-8-6-23(7-9-27)21-31-32(37)35-34(39)42-31/h3-17,20,31H,18-19,21-22H2,1-2H3,(H,35,37,39) |
| InChIKey | WIWKPYQXSXDYSU-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|