C22H25N2NaO5S — CID 173361637
sodium;hydride;2-phenylethyl N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylcarbamate (PubChem CID 173361637) has the molecular formula C22H25N2NaO5S and a molecular weight of 452.51 g/mol. Its IUPAC name is sodium;hydride;2-phenylethyl N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylcarbamate.
| Compound Name | sodium;hydride;2-phenylethyl N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 173361637 |
| Molecular Formula | C22H25N2NaO5S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | sodium;hydride;2-phenylethyl N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylcarbamate |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)C(=O)OCCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C22H24N2O5S.Na.H/c1-24(22(27)29-13-11-16-5-3-2-4-6-16)12-14-28-18-9-7-17(8-10-18)15-19-20(25)23-21(26)30-19;;/h2-10,19H,11-15H2,1H3,(H,23,25,26);;/q;+1;-1 |
| InChIKey | RQTPXESHEOHWIN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|