C18H19KN3O3S — CID 171990495
CID 171990495 (PubChem CID 171990495) has the molecular formula C18H19KN3O3S and a molecular weight of 396.53 g/mol.
| Compound Name | CID 171990495 |
|---|---|
| PubChem CID | 171990495 |
| Molecular Formula | C18H19KN3O3S |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | — |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1cccnc1.[K] |
| InChI | InChI=1S/C18H19N3O3S.K/c1-21(14-3-2-8-19-12-14)9-10-24-15-6-4-13(5-7-15)11-16-17(22)20-18(23)25-16;/h2-8,12,16H,9-11H2,1H3,(H,20,22,23); |
| InChIKey | LHRPXZBKWPFSIR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|