C20H20N2O4S — CID 86749175
N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylbenzamide (PubChem CID 86749175) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylbenzamide.
| Compound Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 86749175 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]ethyl]-N-methylbenzamide |
| SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-22(19(24)15-5-3-2-4-6-15)11-12-26-16-9-7-14(8-10-16)13-17-18(23)21-20(25)27-17/h2-10,17H,11-13H2,1H3,(H,21,23,25) |
| InChIKey | HCAJTAZCRCVIOW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|