C23H20N2O3S2 — CID 11282007
N-[[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]thiophen-3-yl]methyl]-N-methylbenzamide (PubChem CID 11282007) has the molecular formula C23H20N2O3S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is N-[[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]thiophen-3-yl]methyl]-N-methylbenzamide.
| Compound Name | N-[[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]thiophen-3-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 11282007 |
| Molecular Formula | C23H20N2O3S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[[5-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]thiophen-3-yl]methyl]-N-methylbenzamide |
| SMILES | CN(Cc1csc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S2/c1-25(22(27)18-5-3-2-4-6-18)13-16-12-19(29-14-16)17-9-7-15(8-10-17)11-20-21(26)24-23(28)30-20/h2-10,12,14,20H,11,13H2,1H3,(H,24,26,28) |
| InChIKey | LLPFTTRBMMIIDB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|