C26H30N2O3S — CID 11408335
3-cyclopentyl-N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methylpropanamide (PubChem CID 11408335) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 3-cyclopentyl-N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methylpropanamide.
| Compound Name | 3-cyclopentyl-N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 11408335 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-cyclopentyl-N-[[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]methyl]-N-methylpropanamide |
| SMILES | CN(Cc1cccc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C26H30N2O3S/c1-28(24(29)14-11-18-5-2-3-6-18)17-20-7-4-8-22(15-20)21-12-9-19(10-13-21)16-23-25(30)27-26(31)32-23/h4,7-10,12-13,15,18,23H,2-3,5-6,11,14,16-17H2,1H3,(H,27,30,31) |
| InChIKey | SNMJJYKFDGZVBO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|