C26H36N2O6S — CID 44552376
methyl 2-[2-[5-cyclohexylpentanoyl(methyl)amino]ethoxy]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzoate (PubChem CID 44552376) has the molecular formula C26H36N2O6S and a molecular weight of 504.65 g/mol. Its IUPAC name is methyl 2-[2-[5-cyclohexylpentanoyl(methyl)amino]ethoxy]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzoate.
| Compound Name | methyl 2-[2-[5-cyclohexylpentanoyl(methyl)amino]ethoxy]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzoate |
|---|---|
| PubChem CID | 44552376 |
| Molecular Formula | C26H36N2O6S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl 2-[2-[5-cyclohexylpentanoyl(methyl)amino]ethoxy]-5-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]benzoate |
| SMILES | COC(=O)c1cc(CC2SC(=O)NC2=O)ccc1OCCN(C)C(=O)CCCCC1CCCCC1 |
| InChI | InChI=1S/C26H36N2O6S/c1-28(23(29)11-7-6-10-18-8-4-3-5-9-18)14-15-34-21-13-12-19(16-20(21)25(31)33-2)17-22-24(30)27-26(32)35-22/h12-13,16,18,22H,3-11,14-15,17H2,1-2H3,(H,27,30,32) |
| InChIKey | VUAKRNYHDHDPFP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|