C17H13N2O4S- — CID 22341438
N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]carbamate (PubChem CID 22341438) has the molecular formula C17H13N2O4S- and a molecular weight of 341.37 g/mol. Its IUPAC name is N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]carbamate.
| Compound Name | N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 22341438 |
| Molecular Formula | C17H13N2O4S- |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]carbamate |
| SMILES | O=C([O-])Nc1cccc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C17H14N2O4S/c20-15-14(24-17(23)19-15)8-10-4-6-11(7-5-10)12-2-1-3-13(9-12)18-16(21)22/h1-7,9,14,18H,8H2,(H,21,22)(H,19,20,23)/p-1 |
| InChIKey | PSUFHGLXFQNTQR-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|