C10H8N2O4S — CID 12830996
5-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 12830996) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 5-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12830996 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 5-[(4-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C10H8N2O4S/c13-9-8(17-10(14)11-9)5-6-1-3-7(4-2-6)12(15)16/h1-4,8H,5H2,(H,11,13,14) |
| InChIKey | ZOTJXMUBXNQJKZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|