C11H10N2O4S — CID 7066089
2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(3-hydroxyphenyl)acetamide (PubChem CID 7066089) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(3-hydroxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 7066089 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-[(5S)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(C[C@@H]1SC(=O)NC1=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C11H10N2O4S/c14-7-3-1-2-6(4-7)12-9(15)5-8-10(16)13-11(17)18-8/h1-4,8,14H,5H2,(H,12,15)(H,13,16,17)/t8-/m0/s1 |
| InChIKey | NFFMWUIMXITYGA-QMMMGPOBSA-N |
| XLogP | 1.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|