C12H10N2O6S — CID 4970447
2-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]-5-hydroxybenzoic acid (PubChem CID 4970447) has the molecular formula C12H10N2O6S and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4970447 |
| Molecular Formula | C12H10N2O6S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1,3-thiazolidin-5-yl)acetyl]amino]-5-hydroxybenzoic acid |
| SMILES | O=C(CC1SC(=O)NC1=O)Nc1ccc(O)cc1C(=O)O |
| InChI | InChI=1S/C12H10N2O6S/c15-5-1-2-7(6(3-5)11(18)19)13-9(16)4-8-10(17)14-12(20)21-8/h1-3,8,15H,4H2,(H,13,16)(H,18,19)(H,14,17,20) |
| InChIKey | BYRZLSQEYQPUKJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|