C23H19N3O3S — CID 51134753
2-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]-N-phenylbenzamide (PubChem CID 51134753) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 51134753 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3S/c27-21(14-20-23(29)26-18-12-6-7-13-19(18)30-20)25-17-11-5-4-10-16(17)22(28)24-15-8-2-1-3-9-15/h1-13,20H,14H2,(H,24,28)(H,25,27)(H,26,29) |
| InChIKey | JPUNATKSAWRXBO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |