C16H15N3O4S2 — CID 2242401
2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 2242401) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 2242401 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C[C@@H]2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C16H15N3O4S2/c17-25(22,23)11-7-5-10(6-8-11)18-15(20)9-14-16(21)19-12-3-1-2-4-13(12)24-14/h1-8,14H,9H2,(H,18,20)(H,19,21)(H2,17,22,23)/t14-/m0/s1 |
| InChIKey | PPNQRSVWLPPAIU-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |