C12H11N3O4S — CID 27350767
N'-[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]benzohydrazide (PubChem CID 27350767) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is N'-[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 27350767 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N'-[2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]acetyl]benzohydrazide |
| SMILES | O=C(C[C@H]1SC(=O)NC1=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11N3O4S/c16-9(6-8-11(18)13-12(19)20-8)14-15-10(17)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,14,16)(H,15,17)(H,13,18,19)/t8-/m1/s1 |
| InChIKey | HGFSOLUXTOLUGK-MRVPVSSYSA-N |
| XLogP | 0.19 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|