C19H13F6N3O3S — CID 2820248
N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-3,5-bis(trifluoromethyl)benzohydrazide (PubChem CID 2820248) has the molecular formula C19H13F6N3O3S and a molecular weight of 477.39 g/mol. Its IUPAC name is N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-3,5-bis(trifluoromethyl)benzohydrazide.
| Compound Name | N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-3,5-bis(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 2820248 |
| Molecular Formula | C19H13F6N3O3S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-3,5-bis(trifluoromethyl)benzohydrazide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F6N3O3S/c20-18(21,22)10-5-9(6-11(7-10)19(23,24)25)16(30)28-27-15(29)8-14-17(31)26-12-3-1-2-4-13(12)32-14/h1-7,14H,8H2,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | HFCQGGJZTRVPRX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|