C14H14F3N3O4S — CID 42927248
ethyl N-[[2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetyl]amino]carbamate (PubChem CID 42927248) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is ethyl N-[[2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetyl]amino]carbamate.
| Compound Name | ethyl N-[[2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetyl]amino]carbamate |
|---|---|
| PubChem CID | 42927248 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | ethyl N-[[2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetyl]amino]carbamate |
| SMILES | CCOC(=O)NNC(=O)CC1Sc2ccc(C(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C14H14F3N3O4S/c1-2-24-13(23)20-19-11(21)6-10-12(22)18-8-5-7(14(15,16)17)3-4-9(8)25-10/h3-5,10H,2,6H2,1H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | KGQIGCFPTFOPLC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|