C21H22F3N3O2S — CID 46410256
N-[4-(diethylamino)phenyl]-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 46410256) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 46410256 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CC2Sc3ccc(C(F)(F)F)cc3NC2=O)cc1 |
| InChI | InChI=1S/C21H22F3N3O2S/c1-3-27(4-2)15-8-6-14(7-9-15)25-19(28)12-18-20(29)26-16-11-13(21(22,23)24)5-10-17(16)30-18/h5-11,18H,3-4,12H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | PTYNXIVXXNFAQV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|