C17H12F3N3O4S — CID 7116072
N-(4-nitrophenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 7116072) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is N-(4-nitrophenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-(4-nitrophenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 7116072 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | N-(4-nitrophenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1Sc2ccc(C(F)(F)F)cc2NC1=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12F3N3O4S/c18-17(19,20)9-1-6-13-12(7-9)22-16(25)14(28-13)8-15(24)21-10-2-4-11(5-3-10)23(26)27/h1-7,14H,8H2,(H,21,24)(H,22,25)/t14-/m1/s1 |
| InChIKey | BPEOAIDGXHPDIH-CQSZACIVSA-N |
| XLogP | 4.06 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|