C18H14F3IN2O2S — CID 1190330
N-(4-iodo-2-methylphenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 1190330) has the molecular formula C18H14F3IN2O2S and a molecular weight of 506.29 g/mol. Its IUPAC name is N-(4-iodo-2-methylphenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-(4-iodo-2-methylphenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 1190330 |
| Molecular Formula | C18H14F3IN2O2S |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | N-(4-iodo-2-methylphenyl)-2-[(2R)-3-oxo-6-(trifluoromethyl)-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | Cc1cc(I)ccc1NC(=O)C[C@H]1Sc2ccc(C(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C18H14F3IN2O2S/c1-9-6-11(22)3-4-12(9)23-16(25)8-15-17(26)24-13-7-10(18(19,20)21)2-5-14(13)27-15/h2-7,15H,8H2,1H3,(H,23,25)(H,24,26)/t15-/m1/s1 |
| InChIKey | RSITZWWKIUECDL-OAHLLOKOSA-N |
| XLogP | 5.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|