C21H22N4O5S2 — CID 24634893
N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide (PubChem CID 24634893) has the molecular formula C21H22N4O5S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide.
| Compound Name | N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 24634893 |
| Molecular Formula | C21H22N4O5S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]-4-pyrrolidin-1-ylsulfonylbenzohydrazide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)NNC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H22N4O5S2/c26-19(13-18-21(28)22-16-5-1-2-6-17(16)31-18)23-24-20(27)14-7-9-15(10-8-14)32(29,30)25-11-3-4-12-25/h1-2,5-10,18H,3-4,11-13H2,(H,22,28)(H,23,26)(H,24,27) |
| InChIKey | LYYZBPSNGRNIOV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|