C21H22N4O3S — CID 7775150
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetohydrazide (PubChem CID 7775150) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetohydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 7775150 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetohydrazide |
| SMILES | O=C(C[C@H]1Sc2ccccc2NC1=O)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C21H22N4O3S/c26-19(12-18-21(28)22-15-8-2-4-10-17(15)29-18)23-24-20(27)13-25-11-5-7-14-6-1-3-9-16(14)25/h1-4,6,8-10,18H,5,7,11-13H2,(H,22,28)(H,23,26)(H,24,27)/t18-/m1/s1 |
| InChIKey | LMASOINDKRQXJB-GOSISDBHSA-N |
| XLogP | 2.09 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|