C15H19N3O2S — CID 9271504
2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-piperidin-1-ylacetamide (PubChem CID 9271504) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-piperidin-1-ylacetamide.
| Compound Name | 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 9271504 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]-N-piperidin-1-ylacetamide |
| SMILES | O=C(C[C@H]1Sc2ccccc2NC1=O)NN1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2S/c19-14(17-18-8-4-1-5-9-18)10-13-15(20)16-11-6-2-3-7-12(11)21-13/h2-3,6-7,13H,1,4-5,8-10H2,(H,16,20)(H,17,19)/t13-/m1/s1 |
| InChIKey | ZXQCGQPKRBJBGE-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |