C20H18N4O4S — CID 55481212
N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 55481212) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
| Compound Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
|---|---|
| PubChem CID | 55481212 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | N-(4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | CC1(c2ccccc2)NC(=O)N(NC(=O)CC2Sc3ccccc3NC2=O)C1=O |
| InChI | InChI=1S/C20H18N4O4S/c1-20(12-7-3-2-4-8-12)18(27)24(19(28)22-20)23-16(25)11-15-17(26)21-13-9-5-6-10-14(13)29-15/h2-10,15H,11H2,1H3,(H,21,26)(H,22,28)(H,23,25) |
| InChIKey | OLLNMBWTFPNSFJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|