C19H27N3O2S — CID 9472923
N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 9472923) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 9472923 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[3-[(2S)-2-methylpiperidin-1-yl]propyl]-2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | C[C@H]1CCCCN1CCCNC(=O)C[C@H]1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C19H27N3O2S/c1-14-7-4-5-11-22(14)12-6-10-20-18(23)13-17-19(24)21-15-8-2-3-9-16(15)25-17/h2-3,8-9,14,17H,4-7,10-13H2,1H3,(H,20,23)(H,21,24)/t14-,17+/m0/s1 |
| InChIKey | NCNHTNZYMSYGRU-WMLDXEAASA-N |
| XLogP | 2.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|