C20H29N3O2S — CID 92696595
N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 92696595) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 92696595 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)C[C@@H]1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C20H29N3O2S/c1-2-15-8-5-6-12-23(15)13-7-11-21-19(24)14-18-20(25)22-16-9-3-4-10-17(16)26-18/h3-4,9-10,15,18H,2,5-8,11-14H2,1H3,(H,21,24)(H,22,25)/t15-,18-/m0/s1 |
| InChIKey | ZGDHEOYRFAQULK-YJBOKZPZSA-N |
| XLogP | 3.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|