C17H17N3O4S — CID 4787467
2,5-dimethyl-N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]furan-3-carbohydrazide (PubChem CID 4787467) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 4787467 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2,5-dimethyl-N'-[2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)CC2Sc3ccccc3NC2=O)c(C)o1 |
| InChI | InChI=1S/C17H17N3O4S/c1-9-7-11(10(2)24-9)16(22)20-19-15(21)8-14-17(23)18-12-5-3-4-6-13(12)25-14/h3-7,14H,8H2,1-2H3,(H,18,23)(H,19,21)(H,20,22) |
| InChIKey | WWCNOTHCYIMBOT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|