C25H29NO4S — CID 22341530
2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]nonanoic acid (PubChem CID 22341530) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]nonanoic acid.
| Compound Name | 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]nonanoic acid |
|---|---|
| PubChem CID | 22341530 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]nonanoic acid |
| SMILES | CCCCCCCC(C(=O)O)c1cccc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C25H29NO4S/c1-2-3-4-5-6-10-21(24(28)29)20-9-7-8-19(16-20)18-13-11-17(12-14-18)15-22-23(27)26-25(30)31-22/h7-9,11-14,16,21-22H,2-6,10,15H2,1H3,(H,28,29)(H,26,27,30) |
| InChIKey | KQKSMZANAVZZGJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|