C27H26N2O3S — CID 22341528
N-[2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]ethyl]-3-phenylpropanamide (PubChem CID 22341528) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]ethyl]-3-phenylpropanamide.
| Compound Name | N-[2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 22341528 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]phenyl]ethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCCc1cccc(-c2ccc(CC3SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C27H26N2O3S/c30-25(14-11-19-5-2-1-3-6-19)28-16-15-20-7-4-8-23(17-20)22-12-9-21(10-13-22)18-24-26(31)29-27(32)33-24/h1-10,12-13,17,24H,11,14-16,18H2,(H,28,30)(H,29,31,32) |
| InChIKey | NBVXZAMDKCQWBU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|