C23H21N3O4S — CID 22418100
N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 22418100) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 22418100 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methyl-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)NCCc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C23H21N3O4S/c1-14-19(25-22(30-14)17-5-3-2-4-6-17)21(28)24-12-11-15-7-9-16(10-8-15)13-18-20(27)26-23(29)31-18/h2-10,18H,11-13H2,1H3,(H,24,28)(H,26,27,29) |
| InChIKey | BEQWBHUXIWAPHW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|