C22H21N3O4S — CID 22418098
N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 22418098) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22418098 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-[2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]ethyl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NCCc3ccc(CC4SC(=O)NC4=O)cc3)cc2c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-29-16-6-7-17-15(11-16)12-18(24-17)20(26)23-9-8-13-2-4-14(5-3-13)10-19-21(27)25-22(28)30-19/h2-7,11-12,19,24H,8-10H2,1H3,(H,23,26)(H,25,27,28) |
| InChIKey | RFOVMCLRQTYVFI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|