C26H23NO5S — CID 10310674
5-[[4-[4-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 10310674) has the molecular formula C26H23NO5S and a molecular weight of 461.54 g/mol. Its IUPAC name is 5-[[4-[4-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[4-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 10310674 |
| Molecular Formula | C26H23NO5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-[[4-[4-[(Z)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C\c2ccc(Oc3ccc(CC4SC(=O)NC4=O)cc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C26H23NO5S/c1-30-22-13-19(14-23(16-22)31-2)4-3-17-5-9-20(10-6-17)32-21-11-7-18(8-12-21)15-24-25(28)27-26(29)33-24/h3-14,16,24H,15H2,1-2H3,(H,27,28,29)/b4-3- |
| InChIKey | FMYWTYVFYLFWDN-ARJAWSKDSA-N |
| XLogP | 5.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|