C27H27NO3S — CID 59099682
5-[[4-[4-[1-(3,5-dimethylphenyl)propan-2-yl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 59099682) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is 5-[[4-[4-[1-(3,5-dimethylphenyl)propan-2-yl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[4-[1-(3,5-dimethylphenyl)propan-2-yl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59099682 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 5-[[4-[4-[1-(3,5-dimethylphenyl)propan-2-yl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(C)cc(CC(C)c2ccc(Oc3ccc(CC4SC(=O)NC4=O)cc3)cc2)c1 |
| InChI | InChI=1S/C27H27NO3S/c1-17-12-18(2)14-21(13-17)15-19(3)22-6-10-24(11-7-22)31-23-8-4-20(5-9-23)16-25-26(29)28-27(30)32-25/h4-14,19,25H,15-16H2,1-3H3,(H,28,29,30) |
| InChIKey | OYBWIUGKJJSHJQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|