C21H22N2O5S — CID 10047414
methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-methylphenyl]propanoate (PubChem CID 10047414) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-methylphenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-methylphenyl]propanoate |
|---|---|
| PubChem CID | 10047414 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | methyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-2-methylphenyl]propanoate |
| SMILES | COC(=O)C(N)Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1C |
| InChI | InChI=1S/C21H22N2O5S/c1-12-9-16(8-5-14(12)11-17(22)20(25)27-2)28-15-6-3-13(4-7-15)10-18-19(24)23-21(26)29-18/h3-9,17-18H,10-11,22H2,1-2H3,(H,23,24,26) |
| InChIKey | OFULTZRBCZWYBV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|