C20H17AsFNO5S — CID 87850765
CID 87850765 (PubChem CID 87850765) has the molecular formula C20H17AsFNO5S and a molecular weight of 477.35 g/mol.
| Compound Name | CID 87850765 |
|---|---|
| PubChem CID | 87850765 |
| Molecular Formula | C20H17AsFNO5S |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]([As])Cc1ccc(Oc2ccc(CC3SC(=O)NC3=O)cc2F)cc1 |
| InChI | InChI=1S/C20H17AsFNO5S/c1-27-19(25)14(21)8-11-2-5-13(6-3-11)28-16-7-4-12(9-15(16)22)10-17-18(24)23-20(26)29-17/h2-7,9,14,17H,8,10H2,1H3,(H,23,24,26)/t14-,17?/m0/s1 |
| InChIKey | XWUQBFZMSCVRFW-MBIQTGHCSA-N |
| XLogP | 3.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|