C21H20F2N2O5S — CID 142773715
ethyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-3,5-difluorophenoxy]phenyl]propanoate (PubChem CID 142773715) has the molecular formula C21H20F2N2O5S and a molecular weight of 450.46 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-3,5-difluorophenoxy]phenyl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-3,5-difluorophenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 142773715 |
| Molecular Formula | C21H20F2N2O5S |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | ethyl 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-3,5-difluorophenoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(Oc2cc(F)c(CC3SC(=O)NC3=O)c(F)c2)cc1 |
| InChI | InChI=1S/C21H20F2N2O5S/c1-2-29-20(27)17(24)7-11-3-5-12(6-4-11)30-13-8-15(22)14(16(23)9-13)10-18-19(26)25-21(28)31-18/h3-6,8-9,17-18H,2,7,10,24H2,1H3,(H,25,26,28) |
| InChIKey | GFNFBEZPVIVAHM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|