C20H20N2O5S — CID 10318792
2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methylphenoxy]phenyl]propanoic acid (PubChem CID 10318792) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methylphenoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methylphenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10318792 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-amino-3-[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]-2-methylphenoxy]phenyl]propanoic acid |
| SMILES | Cc1cc(CC2SC(=O)NC2=O)ccc1Oc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-11-8-13(10-17-18(23)22-20(26)28-17)4-7-16(11)27-14-5-2-12(3-6-14)9-15(21)19(24)25/h2-8,15,17H,9-10,21H2,1H3,(H,24,25)(H,22,23,26) |
| InChIKey | WEEOLUNAKUDMST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|