C19H17FN2O4S2 — CID 142691224
(2S)-2-amino-3-[4-[2-fluoro-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]propanoic acid (PubChem CID 142691224) has the molecular formula C19H17FN2O4S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[2-fluoro-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[2-fluoro-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142691224 |
| Molecular Formula | C19H17FN2O4S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | (2S)-2-amino-3-[4-[2-fluoro-4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(Oc2ccc(CC3SC(=S)NC3=O)cc2F)cc1)C(=O)O |
| InChI | InChI=1S/C19H17FN2O4S2/c20-13-7-11(9-16-17(23)22-19(27)28-16)3-6-15(13)26-12-4-1-10(2-5-12)8-14(21)18(24)25/h1-7,14,16H,8-9,21H2,(H,24,25)(H,22,23,27)/t14-,16?/m0/s1 |
| InChIKey | YQXOMFANMQOOEF-LBAUFKAWSA-N |
| XLogP | 2.63 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|