C19H16N2O4S2 — CID 142691235
2-amino-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoic acid (PubChem CID 142691235) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-amino-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142691235 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-amino-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoic acid |
| SMILES | NC(Cc1ccc(Oc2ccc(C=C3SC(=S)NC3=O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C19H16N2O4S2/c20-15(18(23)24)9-11-1-5-13(6-2-11)25-14-7-3-12(4-8-14)10-16-17(22)21-19(26)27-16/h1-8,10,15H,9,20H2,(H,23,24)(H,21,22,26) |
| InChIKey | XTIJDTLYHSRYKR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|