C23H23N3O6S — CID 11190587
methyl 2-(2-aminopropanoylamino)-3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate (PubChem CID 11190587) has the molecular formula C23H23N3O6S and a molecular weight of 469.52 g/mol. Its IUPAC name is methyl 2-(2-aminopropanoylamino)-3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-aminopropanoylamino)-3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11190587 |
| Molecular Formula | C23H23N3O6S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | methyl 2-(2-aminopropanoylamino)-3-[4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(Oc2ccc(/C=C3/SC(=O)NC3=O)cc2)cc1)NC(=O)C(C)N |
| InChI | InChI=1S/C23H23N3O6S/c1-13(24)20(27)25-18(22(29)31-2)11-14-3-7-16(8-4-14)32-17-9-5-15(6-10-17)12-19-21(28)26-23(30)33-19/h3-10,12-13,18H,11,24H2,1-2H3,(H,25,27)(H,26,28,30)/b19-12+ |
| InChIKey | IFLISWMOOMNTPI-XDHOZWIPSA-N |
| XLogP | 2.35 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|