C20H16Cl2N2O4S2 — CID 89191699
methyl (2S)-2-(chloroamino)-3-[4-[3-chloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate (PubChem CID 89191699) has the molecular formula C20H16Cl2N2O4S2 and a molecular weight of 483.40 g/mol. Its IUPAC name is methyl (2S)-2-(chloroamino)-3-[4-[3-chloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(chloroamino)-3-[4-[3-chloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 89191699 |
| Molecular Formula | C20H16Cl2N2O4S2 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | methyl (2S)-2-(chloroamino)-3-[4-[3-chloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Oc2ccc(/C=C3\SC(=S)NC3=O)c(Cl)c2)cc1)NCl |
| InChI | InChI=1S/C20H16Cl2N2O4S2/c1-27-19(26)16(24-22)8-11-2-5-13(6-3-11)28-14-7-4-12(15(21)10-14)9-17-18(25)23-20(29)30-17/h2-7,9-10,16,24H,8H2,1H3,(H,23,25,29)/b17-9-/t16-/m0/s1 |
| InChIKey | ZNDZXXLPKADRLM-SLHXSTLSSA-N |
| XLogP | 4.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|