C25H21ClN2O4 — CID 25217533
methyl (2S)-2-amino-3-[4-[3-chloro-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate (PubChem CID 25217533) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is methyl (2S)-2-amino-3-[4-[3-chloro-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-amino-3-[4-[3-chloro-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 25217533 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | methyl (2S)-2-amino-3-[4-[3-chloro-4-[(E)-(2-oxo-1H-indol-3-ylidene)methyl]phenoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@@H](N)Cc1ccc(Oc2ccc(/C=C3/C(=O)Nc4ccccc43)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H21ClN2O4/c1-31-25(30)22(27)12-15-6-9-17(10-7-15)32-18-11-8-16(21(26)14-18)13-20-19-4-2-3-5-23(19)28-24(20)29/h2-11,13-14,22H,12,27H2,1H3,(H,28,29)/b20-13+/t22-/m0/s1 |
| InChIKey | QXSWEUKXLIICPE-IMEWXKHHSA-N |
| XLogP | 4.67 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|