C26H25ClN2O4 — CID 143291453
methyl 2-amino-3-[4-[3-chloro-4-[(E)-2-[2-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]phenyl]propanoate (PubChem CID 143291453) has the molecular formula C26H25ClN2O4 and a molecular weight of 464.95 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[3-chloro-4-[(E)-2-[2-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[3-chloro-4-[(E)-2-[2-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 143291453 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | methyl 2-amino-3-[4-[3-chloro-4-[(E)-2-[2-(methylamino)phenyl]-3-oxoprop-1-enyl]phenoxy]phenyl]propanoate |
| SMILES | CNc1ccccc1/C(C=O)=C\c1ccc(Oc2ccc(CC(N)C(=O)OC)cc2)cc1Cl |
| InChI | InChI=1S/C26H25ClN2O4/c1-29-25-6-4-3-5-22(25)19(16-30)14-18-9-12-21(15-23(18)27)33-20-10-7-17(8-11-20)13-24(28)26(31)32-2/h3-12,14-16,24,29H,13,28H2,1-2H3/b19-14- |
| InChIKey | OSCMKPPRXQCDEK-RGEXLXHISA-N |
| XLogP | 4.96 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|