C13H10ClNO4S — CID 157303790
[3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] propanoate (PubChem CID 157303790) has the molecular formula C13H10ClNO4S and a molecular weight of 311.75 g/mol. Its IUPAC name is [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] propanoate.
| Compound Name | [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 157303790 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(/C=C2\SC(=O)NC2=O)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClNO4S/c1-2-11(16)19-8-4-3-7(9(14)6-8)5-10-12(17)15-13(18)20-10/h3-6H,2H2,1H3,(H,15,17,18)/b10-5- |
| InChIKey | UZALIHVMMKTNGW-YHYXMXQVSA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|