C19H16ClNO5S — CID 2895966
5-[[5-chloro-2-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 2895966) has the molecular formula C19H16ClNO5S and a molecular weight of 405.86 g/mol. Its IUPAC name is 5-[[5-chloro-2-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-chloro-2-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 2895966 |
| Molecular Formula | C19H16ClNO5S |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 5-[[5-chloro-2-[2-(4-methoxyphenoxy)ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(OCCOc2ccc(Cl)cc2C=C2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C19H16ClNO5S/c1-24-14-3-5-15(6-4-14)25-8-9-26-16-7-2-13(20)10-12(16)11-17-18(22)21-19(23)27-17/h2-7,10-11H,8-9H2,1H3,(H,21,22,23) |
| InChIKey | KFLCEMFAEJNCAH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|