C20H18ClNO4S — CID 130223069
[3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclohepta-2,4-dien-1-ylpropanoate (PubChem CID 130223069) has the molecular formula C20H18ClNO4S and a molecular weight of 403.89 g/mol. Its IUPAC name is [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclohepta-2,4-dien-1-ylpropanoate.
| Compound Name | [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclohepta-2,4-dien-1-ylpropanoate |
|---|---|
| PubChem CID | 130223069 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [3-chloro-4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl] 3-cyclohepta-2,4-dien-1-ylpropanoate |
| SMILES | O=C(CCC1C=CC=CCC1)Oc1ccc(/C=C2\SC(=O)NC2=O)c(Cl)c1 |
| InChI | InChI=1S/C20H18ClNO4S/c21-16-12-15(9-8-14(16)11-17-19(24)22-20(25)27-17)26-18(23)10-7-13-5-3-1-2-4-6-13/h1-3,5,8-9,11-13H,4,6-7,10H2,(H,22,24,25)/b17-11- |
| InChIKey | DSUBMMJPMXHBAT-BOPFTXTBSA-N |
| XLogP | 4.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|