C20H18ClNO3S — CID 87224671
(5E)-5-[[2-chloro-4-(1-phenylbutoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87224671) has the molecular formula C20H18ClNO3S and a molecular weight of 387.89 g/mol. Its IUPAC name is (5E)-5-[[2-chloro-4-(1-phenylbutoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-chloro-4-(1-phenylbutoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87224671 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | (5E)-5-[[2-chloro-4-(1-phenylbutoxy)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCC(Oc1ccc(/C=C2/SC(=O)NC2=O)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C20H18ClNO3S/c1-2-6-17(13-7-4-3-5-8-13)25-15-10-9-14(16(21)12-15)11-18-19(23)22-20(24)26-18/h3-5,7-12,17H,2,6H2,1H3,(H,22,23,24)/b18-11+ |
| InChIKey | YVJWRVDCVLOJSY-WOJGMQOQSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|