C23H31NO4S — CID 90798505
ethane;5-[[4-(4-methoxy-2,5-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 90798505) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is ethane;5-[[4-(4-methoxy-2,5-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | ethane;5-[[4-(4-methoxy-2,5-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90798505 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | ethane;5-[[4-(4-methoxy-2,5-dimethylphenoxy)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC.CC.COc1cc(C)c(Oc2ccc(CC3SC(=O)NC3=O)cc2)cc1C |
| InChI | InChI=1S/C19H19NO4S.2C2H6/c1-11-9-16(12(2)8-15(11)23-3)24-14-6-4-13(5-7-14)10-17-18(21)20-19(22)25-17;2*1-2/h4-9,17H,10H2,1-3H3,(H,20,21,22);2*1-2H3 |
| InChIKey | QHTMEBBDQSGDDW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|