C24H21NO5S — CID 59768295
5-[[4-[3-(2,4-dimethoxyphenyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 59768295) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is 5-[[4-[3-(2,4-dimethoxyphenyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[3-(2,4-dimethoxyphenyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 59768295 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 5-[[4-[3-(2,4-dimethoxyphenyl)phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(-c2cccc(Oc3ccc(CC4SC(=O)NC4=O)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C24H21NO5S/c1-28-18-10-11-20(21(14-18)29-2)16-4-3-5-19(13-16)30-17-8-6-15(7-9-17)12-22-23(26)25-24(27)31-22/h3-11,13-14,22H,12H2,1-2H3,(H,25,26,27) |
| InChIKey | NQDJUDLOUYUDLZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|