C27H23NO5S — CID 45138038
methyl (E)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-3-(4-methylphenyl)prop-2-enoate (PubChem CID 45138038) has the molecular formula C27H23NO5S and a molecular weight of 473.55 g/mol. Its IUPAC name is methyl (E)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | methyl (E)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 45138038 |
| Molecular Formula | C27H23NO5S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | methyl (E)-2-[3-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]-3-(4-methylphenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1ccc(C)cc1)c1cccc(Oc2ccc(CC3SC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C27H23NO5S/c1-17-6-8-18(9-7-17)14-23(26(30)32-2)20-4-3-5-22(16-20)33-21-12-10-19(11-13-21)15-24-25(29)28-27(31)34-24/h3-14,16,24H,15H2,1-2H3,(H,28,29,31)/b23-14+ |
| InChIKey | QFZSSDSPUYDBAN-OEAKJJBVSA-N |
| XLogP | 5.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|